C18H22N2O3 — CID 71464018
tert-butyl 3-(2-cyanopropan-2-yl)-5-methoxyindole-1-carboxylate (PubChem CID 71464018) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is tert-butyl 3-(2-cyanopropan-2-yl)-5-methoxyindole-1-carboxylate.
| Compound Name | tert-butyl 3-(2-cyanopropan-2-yl)-5-methoxyindole-1-carboxylate |
|---|---|
| PubChem CID | 71464018 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | tert-butyl 3-(2-cyanopropan-2-yl)-5-methoxyindole-1-carboxylate |
| SMILES | COc1ccc2c(c1)c(C(C)(C)C#N)cn2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H22N2O3/c1-17(2,3)23-16(21)20-10-14(18(4,5)11-19)13-9-12(22-6)7-8-15(13)20/h7-10H,1-6H3 |
| InChIKey | YIESVYJWQYZJPD-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 64.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |