C22H26N2O3 — CID 25257746
tert-butyl 3-[(R)-amino-[2-(2-hydroxyethyl)phenyl]methyl]indole-1-carboxylate (PubChem CID 25257746) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is tert-butyl 3-[(R)-amino-[2-(2-hydroxyethyl)phenyl]methyl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[(R)-amino-[2-(2-hydroxyethyl)phenyl]methyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 25257746 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | tert-butyl 3-[(R)-amino-[2-(2-hydroxyethyl)phenyl]methyl]indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc([C@H](N)c2ccccc2CCO)c2ccccc21 |
| InChI | InChI=1S/C22H26N2O3/c1-22(2,3)27-21(26)24-14-18(17-10-6-7-11-19(17)24)20(23)16-9-5-4-8-15(16)12-13-25/h4-11,14,20,25H,12-13,23H2,1-3H3/t20-/m1/s1 |
| InChIKey | VCMIVJNUQKBHKK-HXUWFJFHSA-N |
| XLogP | 4.01 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |