C27H33NO3 — CID 129225199
tert-butyl 3-[4-(4-tert-butylphenyl)-1-oxobutan-2-yl]indole-1-carboxylate (PubChem CID 129225199) has the molecular formula C27H33NO3 and a molecular weight of 419.57 g/mol. Its IUPAC name is tert-butyl 3-[4-(4-tert-butylphenyl)-1-oxobutan-2-yl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[4-(4-tert-butylphenyl)-1-oxobutan-2-yl]indole-1-carboxylate |
|---|---|
| PubChem CID | 129225199 |
| Molecular Formula | C27H33NO3 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | tert-butyl 3-[4-(4-tert-butylphenyl)-1-oxobutan-2-yl]indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(C(C=O)CCc2ccc(C(C)(C)C)cc2)c2ccccc21 |
| InChI | InChI=1S/C27H33NO3/c1-26(2,3)21-15-12-19(13-16-21)11-14-20(18-29)23-17-28(25(30)31-27(4,5)6)24-10-8-7-9-22(23)24/h7-10,12-13,15-18,20H,11,14H2,1-6H3 |
| InChIKey | CKGJJBFNGSWJKI-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|