C28H40N2O3Si — CID 25257959
tert-butyl 3-[(R)-amino-[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]phenyl]methyl]indole-1-carboxylate (PubChem CID 25257959) has the molecular formula C28H40N2O3Si and a molecular weight of 480.73 g/mol. Its IUPAC name is tert-butyl 3-[(R)-amino-[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]phenyl]methyl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[(R)-amino-[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]phenyl]methyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 25257959 |
| Molecular Formula | C28H40N2O3Si |
| Molecular Weight | 480.73 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | tert-butyl 3-[(R)-amino-[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]phenyl]methyl]indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc([C@H](N)c2ccccc2CCO[Si](C)(C)C(C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C28H40N2O3Si/c1-27(2,3)33-26(31)30-19-23(22-15-11-12-16-24(22)30)25(29)21-14-10-9-13-20(21)17-18-32-34(7,8)28(4,5)6/h9-16,19,25H,17-18,29H2,1-8H3/t25-/m1/s1 |
| InChIKey | WRDJSENAYPLGNC-RUZDIDTESA-N |
| XLogP | 7.04 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.73 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|