C22H26ClN3O3 — CID 146019916
tert-butyl 3-[2-amino-1-(phenylmethoxyamino)ethyl]-6-chloroindole-1-carboxylate (PubChem CID 146019916) has the molecular formula C22H26ClN3O3 and a molecular weight of 415.92 g/mol. Its IUPAC name is tert-butyl 3-[2-amino-1-(phenylmethoxyamino)ethyl]-6-chloroindole-1-carboxylate.
| Compound Name | tert-butyl 3-[2-amino-1-(phenylmethoxyamino)ethyl]-6-chloroindole-1-carboxylate |
|---|---|
| PubChem CID | 146019916 |
| Molecular Formula | C22H26ClN3O3 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | tert-butyl 3-[2-amino-1-(phenylmethoxyamino)ethyl]-6-chloroindole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(C(CN)NOCc2ccccc2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C22H26ClN3O3/c1-22(2,3)29-21(27)26-13-18(17-10-9-16(23)11-20(17)26)19(12-24)25-28-14-15-7-5-4-6-8-15/h4-11,13,19,25H,12,14,24H2,1-3H3 |
| InChIKey | NGPZVTGVCLHRDT-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|