C26H27NO6 — CID 134944567
tert-butyl 3-[(R)-hydroxy-[(3S)-4-methylidene-5-oxooxolan-3-yl]methyl]-6-phenylmethoxyindole-1-carboxylate (PubChem CID 134944567) has the molecular formula C26H27NO6 and a molecular weight of 449.50 g/mol. Its IUPAC name is tert-butyl 3-[(R)-hydroxy-[(3S)-4-methylidene-5-oxooxolan-3-yl]methyl]-6-phenylmethoxyindole-1-carboxylate.
| Compound Name | tert-butyl 3-[(R)-hydroxy-[(3S)-4-methylidene-5-oxooxolan-3-yl]methyl]-6-phenylmethoxyindole-1-carboxylate |
|---|---|
| PubChem CID | 134944567 |
| Molecular Formula | C26H27NO6 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | tert-butyl 3-[(R)-hydroxy-[(3S)-4-methylidene-5-oxooxolan-3-yl]methyl]-6-phenylmethoxyindole-1-carboxylate |
| SMILES | C=C1C(=O)OC[C@H]1[C@@H](O)c1cn(C(=O)OC(C)(C)C)c2cc(OCc3ccccc3)ccc12 |
| InChI | InChI=1S/C26H27NO6/c1-16-21(15-32-24(16)29)23(28)20-13-27(25(30)33-26(2,3)4)22-12-18(10-11-19(20)22)31-14-17-8-6-5-7-9-17/h5-13,21,23,28H,1,14-15H2,2-4H3/t21-,23+/m1/s1 |
| InChIKey | CUPMDUWLTVWSRZ-GGAORHGYSA-N |
| XLogP | 4.77 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|