C21H22INO4 — CID 177277556
tert-butyl 3-iodo-6-[(4-methoxyphenyl)methoxy]indole-1-carboxylate (PubChem CID 177277556) has the molecular formula C21H22INO4 and a molecular weight of 479.31 g/mol. Its IUPAC name is tert-butyl 3-iodo-6-[(4-methoxyphenyl)methoxy]indole-1-carboxylate.
| Compound Name | tert-butyl 3-iodo-6-[(4-methoxyphenyl)methoxy]indole-1-carboxylate |
|---|---|
| PubChem CID | 177277556 |
| Molecular Formula | C21H22INO4 |
| Molecular Weight | 479.31 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | tert-butyl 3-iodo-6-[(4-methoxyphenyl)methoxy]indole-1-carboxylate |
| SMILES | COc1ccc(COc2ccc3c(I)cn(C(=O)OC(C)(C)C)c3c2)cc1 |
| InChI | InChI=1S/C21H22INO4/c1-21(2,3)27-20(24)23-12-18(22)17-10-9-16(11-19(17)23)26-13-14-5-7-15(25-4)8-6-14/h5-12H,13H2,1-4H3 |
| InChIKey | XUWQSTHNGHXBKP-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.31 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|