C28H31NO4 — CID 67423451
tert-butyl 3-[2,4-bis(phenylmethoxy)phenyl]azetidine-1-carboxylate (PubChem CID 67423451) has the molecular formula C28H31NO4 and a molecular weight of 445.56 g/mol. Its IUPAC name is tert-butyl 3-[2,4-bis(phenylmethoxy)phenyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2,4-bis(phenylmethoxy)phenyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 67423451 |
| Molecular Formula | C28H31NO4 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | tert-butyl 3-[2,4-bis(phenylmethoxy)phenyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(c2ccc(OCc3ccccc3)cc2OCc2ccccc2)C1 |
| InChI | InChI=1S/C28H31NO4/c1-28(2,3)33-27(30)29-17-23(18-29)25-15-14-24(31-19-21-10-6-4-7-11-21)16-26(25)32-20-22-12-8-5-9-13-22/h4-16,23H,17-20H2,1-3H3 |
| InChIKey | LHKKAMPPXZPPBZ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |