C32H36N2O5 — CID 123929349
(1-carbamoylcyclohexyl) 3-[2,4-bis(phenylmethoxy)phenyl]pyrrolidine-1-carboxylate (PubChem CID 123929349) has the molecular formula C32H36N2O5 and a molecular weight of 528.65 g/mol. Its IUPAC name is (1-carbamoylcyclohexyl) 3-[2,4-bis(phenylmethoxy)phenyl]pyrrolidine-1-carboxylate.
| Compound Name | (1-carbamoylcyclohexyl) 3-[2,4-bis(phenylmethoxy)phenyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 123929349 |
| Molecular Formula | C32H36N2O5 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | (1-carbamoylcyclohexyl) 3-[2,4-bis(phenylmethoxy)phenyl]pyrrolidine-1-carboxylate |
| SMILES | NC(=O)C1(OC(=O)N2CCC(c3ccc(OCc4ccccc4)cc3OCc3ccccc3)C2)CCCCC1 |
| InChI | InChI=1S/C32H36N2O5/c33-30(35)32(17-8-3-9-18-32)39-31(36)34-19-16-26(21-34)28-15-14-27(37-22-24-10-4-1-5-11-24)20-29(28)38-23-25-12-6-2-7-13-25/h1-2,4-7,10-15,20,26H,3,8-9,16-19,21-23H2,(H2,33,35) |
| InChIKey | TUFKNVQZDBLGBL-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |