C17H17ClN4O2S — CID 175836981
2-(1-tert-butyl-5-chloroindole-3-carbonyl)-N'-hydroxy-1,3-thiazole-4-carboximidamide (PubChem CID 175836981) has the molecular formula C17H17ClN4O2S and a molecular weight of 376.87 g/mol. Its IUPAC name is 2-(1-tert-butyl-5-chloroindole-3-carbonyl)-N'-hydroxy-1,3-thiazole-4-carboximidamide.
| Compound Name | 2-(1-tert-butyl-5-chloroindole-3-carbonyl)-N'-hydroxy-1,3-thiazole-4-carboximidamide |
|---|---|
| PubChem CID | 175836981 |
| Molecular Formula | C17H17ClN4O2S |
| Molecular Weight | 376.87 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 2-(1-tert-butyl-5-chloroindole-3-carbonyl)-N'-hydroxy-1,3-thiazole-4-carboximidamide |
| SMILES | CC(C)(C)n1cc(C(=O)c2nc(C(N)=NO)cs2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C17H17ClN4O2S/c1-17(2,3)22-7-11(10-6-9(18)4-5-13(10)22)14(23)16-20-12(8-25-16)15(19)21-24/h4-8,24H,1-3H3,(H2,19,21) |
| InChIKey | DUHALRMOGLXDQZ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.87 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|