C16H30N2OSi — CID 140891501
N-tert-butyl-6-[[tert-butyl(dimethyl)silyl]oxymethyl]pyridin-2-amine (PubChem CID 140891501) has the molecular formula C16H30N2OSi and a molecular weight of 294.51 g/mol. Its IUPAC name is N-tert-butyl-6-[[tert-butyl(dimethyl)silyl]oxymethyl]pyridin-2-amine.
| Compound Name | N-tert-butyl-6-[[tert-butyl(dimethyl)silyl]oxymethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 140891501 |
| Molecular Formula | C16H30N2OSi |
| Molecular Weight | 294.51 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | N-tert-butyl-6-[[tert-butyl(dimethyl)silyl]oxymethyl]pyridin-2-amine |
| SMILES | CC(C)(C)Nc1cccc(CO[Si](C)(C)C(C)(C)C)n1 |
| InChI | InChI=1S/C16H30N2OSi/c1-15(2,3)18-14-11-9-10-13(17-14)12-19-20(7,8)16(4,5)6/h9-11H,12H2,1-8H3,(H,17,18) |
| InChIKey | FMDIKOPNSBRLGE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.51 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|