C22H34N2OSi — CID 69157669
1-[6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-pyridinyl]-N-(2-phenylethyl)ethanamine (PubChem CID 69157669) has the molecular formula C22H34N2OSi and a molecular weight of 370.61 g/mol. Its IUPAC name is 1-[6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-pyridinyl]-N-(2-phenylethyl)ethanamine.
| Compound Name | 1-[6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-pyridinyl]-N-(2-phenylethyl)ethanamine |
|---|---|
| PubChem CID | 69157669 |
| Molecular Formula | C22H34N2OSi |
| Molecular Weight | 370.61 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 1-[6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-pyridinyl]-N-(2-phenylethyl)ethanamine |
| SMILES | CC(NCCc1ccccc1)c1cccc(CO[Si](C)(C)C(C)(C)C)n1 |
| InChI | InChI=1S/C22H34N2OSi/c1-18(23-16-15-19-11-8-7-9-12-19)21-14-10-13-20(24-21)17-25-26(5,6)22(2,3)4/h7-14,18,23H,15-17H2,1-6H3 |
| InChIKey | NRRCFIXVNFLHOL-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.61 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|