C18H32N2O2Si — CID 155933037
1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-(2-phenylethyl)urea (PubChem CID 155933037) has the molecular formula C18H32N2O2Si and a molecular weight of 336.55 g/mol. Its IUPAC name is 1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-(2-phenylethyl)urea.
| Compound Name | 1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-(2-phenylethyl)urea |
|---|---|
| PubChem CID | 155933037 |
| Molecular Formula | C18H32N2O2Si |
| Molecular Weight | 336.55 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-(2-phenylethyl)urea |
| SMILES | CC(C)(C)[Si](C)(C)OCCCNC(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C18H32N2O2Si/c1-18(2,3)23(4,5)22-15-9-13-19-17(21)20-14-12-16-10-7-6-8-11-16/h6-8,10-11H,9,12-15H2,1-5H3,(H2,19,20,21) |
| InChIKey | KNMXHNJGAFMLAI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.55 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|