C12H19IN2OSSi — CID 22631614
tert-butyl-[(7-iodoimidazo[5,1-b][1,3]thiazol-3-yl)methoxy]-dimethylsilane (PubChem CID 22631614) has the molecular formula C12H19IN2OSSi and a molecular weight of 394.35 g/mol. Its IUPAC name is tert-butyl-[(7-iodoimidazo[5,1-b][1,3]thiazol-3-yl)methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(7-iodoimidazo[5,1-b][1,3]thiazol-3-yl)methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 22631614 |
| Molecular Formula | C12H19IN2OSSi |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 394.00 |
| IUPAC Name | tert-butyl-[(7-iodoimidazo[5,1-b][1,3]thiazol-3-yl)methoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCc1csc2c(I)ncn12 |
| InChI | InChI=1S/C12H19IN2OSSi/c1-12(2,3)18(4,5)16-6-9-7-17-11-10(13)14-8-15(9)11/h7-8H,6H2,1-5H3 |
| InChIKey | XRGFVQUTGDXPBI-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|