C13H23N3OSi — CID 20728224
tert-butyl-[[3-(2-isocyanoethyl)imidazol-4-yl]methoxy]-dimethylsilane (PubChem CID 20728224) has the molecular formula C13H23N3OSi and a molecular weight of 265.43 g/mol. Its IUPAC name is tert-butyl-[[3-(2-isocyanoethyl)imidazol-4-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[3-(2-isocyanoethyl)imidazol-4-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 20728224 |
| Molecular Formula | C13H23N3OSi |
| Molecular Weight | 265.43 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | tert-butyl-[[3-(2-isocyanoethyl)imidazol-4-yl]methoxy]-dimethylsilane |
| SMILES | [C-]#[N+]CCn1cncc1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H23N3OSi/c1-13(2,3)18(5,6)17-10-12-9-15-11-16(12)8-7-14-4/h9,11H,7-8,10H2,1-3,5-6H3 |
| InChIKey | BIBMAFLSHFBWGO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 31.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|