C11H23N3OSi — CID 69188963
tert-butyl-[(1-ethyl-1,2,4-triazol-3-yl)methoxy]-dimethylsilane (PubChem CID 69188963) has the molecular formula C11H23N3OSi and a molecular weight of 241.41 g/mol. Its IUPAC name is tert-butyl-[(1-ethyl-1,2,4-triazol-3-yl)methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1-ethyl-1,2,4-triazol-3-yl)methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 69188963 |
| Molecular Formula | C11H23N3OSi |
| Molecular Weight | 241.41 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | tert-butyl-[(1-ethyl-1,2,4-triazol-3-yl)methoxy]-dimethylsilane |
| SMILES | CCn1cnc(CO[Si](C)(C)C(C)(C)C)n1 |
| InChI | InChI=1S/C11H23N3OSi/c1-7-14-9-12-10(13-14)8-15-16(5,6)11(2,3)4/h9H,7-8H2,1-6H3 |
| InChIKey | DENFLBKYWXKUQE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|