C13H24N2O3Si — CID 174156217
2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methylpyrazol-1-yl]acetic acid (PubChem CID 174156217) has the molecular formula C13H24N2O3Si and a molecular weight of 284.43 g/mol. Its IUPAC name is 2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methylpyrazol-1-yl]acetic acid.
| Compound Name | 2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methylpyrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 174156217 |
| Molecular Formula | C13H24N2O3Si |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methylpyrazol-1-yl]acetic acid |
| SMILES | Cc1cc(CO[Si](C)(C)C(C)(C)C)nn1CC(=O)O |
| InChI | InChI=1S/C13H24N2O3Si/c1-10-7-11(14-15(10)8-12(16)17)9-18-19(5,6)13(2,3)4/h7H,8-9H2,1-6H3,(H,16,17) |
| InChIKey | PSCHTPZDJAWWPK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|