C15H29N3O3Si — CID 170987272
1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-N-methoxy-N,5-dimethylpyrazole-3-carboxamide (PubChem CID 170987272) has the molecular formula C15H29N3O3Si and a molecular weight of 327.50 g/mol. Its IUPAC name is 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-N-methoxy-N,5-dimethylpyrazole-3-carboxamide.
| Compound Name | 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-N-methoxy-N,5-dimethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 170987272 |
| Molecular Formula | C15H29N3O3Si |
| Molecular Weight | 327.50 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-N-methoxy-N,5-dimethylpyrazole-3-carboxamide |
| SMILES | CON(C)C(=O)c1cc(C)n(CCO[Si](C)(C)C(C)(C)C)n1 |
| InChI | InChI=1S/C15H29N3O3Si/c1-12-11-13(14(19)17(5)20-6)16-18(12)9-10-21-22(7,8)15(2,3)4/h11H,9-10H2,1-8H3 |
| InChIKey | CQRQUOAJCJBBNF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|