C16H30N2O4Si — CID 170618769
ethyl 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-ethoxypyrazole-5-carboxylate (PubChem CID 170618769) has the molecular formula C16H30N2O4Si and a molecular weight of 342.51 g/mol. Its IUPAC name is ethyl 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-ethoxypyrazole-5-carboxylate.
| Compound Name | ethyl 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-ethoxypyrazole-5-carboxylate |
|---|---|
| PubChem CID | 170618769 |
| Molecular Formula | C16H30N2O4Si |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | ethyl 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-ethoxypyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(OCC)nn1CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H30N2O4Si/c1-8-20-14-12-13(15(19)21-9-2)18(17-14)10-11-22-23(6,7)16(3,4)5/h12H,8-11H2,1-7H3 |
| InChIKey | CJMGBJZAOVYHRM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|