C15H28N2O3Si — CID 123183262
ethyl 3-[tert-butyl(dimethyl)silyl]oxy-1-propylpyrazole-5-carboxylate (PubChem CID 123183262) has the molecular formula C15H28N2O3Si and a molecular weight of 312.49 g/mol. Its IUPAC name is ethyl 3-[tert-butyl(dimethyl)silyl]oxy-1-propylpyrazole-5-carboxylate.
| Compound Name | ethyl 3-[tert-butyl(dimethyl)silyl]oxy-1-propylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 123183262 |
| Molecular Formula | C15H28N2O3Si |
| Molecular Weight | 312.49 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | ethyl 3-[tert-butyl(dimethyl)silyl]oxy-1-propylpyrazole-5-carboxylate |
| SMILES | CCCn1nc(O[Si](C)(C)C(C)(C)C)cc1C(=O)OCC |
| InChI | InChI=1S/C15H28N2O3Si/c1-8-10-17-12(14(18)19-9-2)11-13(16-17)20-21(6,7)15(3,4)5/h11H,8-10H2,1-7H3 |
| InChIKey | ZEVKSKALVOPQJX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|