About ethyl 3-tert-butyl-1-(2,2-difluoroethyl)pyrazole-5-carboxylate
ethyl 3-tert-butyl-1-(2,2-difluoroethyl)pyrazole-5-carboxylate (PubChem CID 130229665) has the molecular formula C12H18F2N2O2
and a molecular weight of 260.28 g/mol. Its IUPAC name is ethyl 3-tert-butyl-1-(2,2-difluoroethyl)pyrazole-5-carboxylate.
Analyze ethyl 3-tert-butyl-1-(2,2-difluoroethyl)pyrazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-tert-butyl-1-(2,2-difluoroethyl)pyrazole-5-carboxylate?
The IUPAC name of ethyl 3-tert-butyl-1-(2,2-difluoroethyl)pyrazole-5-carboxylate (CID 130229665) is ethyl 3-tert-butyl-1-(2,2-difluoroethyl)pyrazole-5-carboxylate.
What is the SMILES notation for ethyl 3-tert-butyl-1-(2,2-difluoroethyl)pyrazole-5-carboxylate?
The canonical SMILES for ethyl 3-tert-butyl-1-(2,2-difluoroethyl)pyrazole-5-carboxylate is CCOC(=O)c1cc(C(C)(C)C)nn1CC(F)F.
What is the InChIKey of ethyl 3-tert-butyl-1-(2,2-difluoroethyl)pyrazole-5-carboxylate?
The InChIKey is CMXPOTWWZGFOEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F2N2O2/c1-5-18-11(17)8-6-9(12(2,3)4)15-16(8)7-10(13)14/h6,10H,5,7H2,1-4H3.
What are the key properties of ethyl 3-tert-butyl-1-(2,2-difluoroethyl)pyrazole-5-carboxylate?
ethyl 3-tert-butyl-1-(2,2-difluoroethyl)pyrazole-5-carboxylate has a molecular weight of 260.28 g/mol, XLogP of 2.62, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-tert-butyl-1-(2,2-difluoroethyl)pyrazole-5-carboxylate is sourced from PubChem (CID 130229665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).