C8H11F2N3O2 — CID 97298350
ethyl 3-amino-1-(2,2-difluoroethyl)pyrazole-4-carboxylate (PubChem CID 97298350) has the molecular formula C8H11F2N3O2 and a molecular weight of 219.19 g/mol. Its IUPAC name is ethyl 3-amino-1-(2,2-difluoroethyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 3-amino-1-(2,2-difluoroethyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 97298350 |
| Molecular Formula | C8H11F2N3O2 |
| Molecular Weight | 219.19 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | ethyl 3-amino-1-(2,2-difluoroethyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(CC(F)F)nc1N |
| InChI | InChI=1S/C8H11F2N3O2/c1-2-15-8(14)5-3-13(4-6(9)10)12-7(5)11/h3,6H,2,4H2,1H3,(H2,11,12) |
| InChIKey | TUPHLWIONCYQAF-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.19 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |