C8H9F2N3O4 — CID 122170828
ethyl 1-(2,2-difluoroethyl)-4-nitropyrazole-3-carboxylate (PubChem CID 122170828) has the molecular formula C8H9F2N3O4 and a molecular weight of 249.17 g/mol. Its IUPAC name is ethyl 1-(2,2-difluoroethyl)-4-nitropyrazole-3-carboxylate.
| Compound Name | ethyl 1-(2,2-difluoroethyl)-4-nitropyrazole-3-carboxylate |
|---|---|
| PubChem CID | 122170828 |
| Molecular Formula | C8H9F2N3O4 |
| Molecular Weight | 249.17 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | ethyl 1-(2,2-difluoroethyl)-4-nitropyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1nn(CC(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H9F2N3O4/c1-2-17-8(14)7-5(13(15)16)3-12(11-7)4-6(9)10/h3,6H,2,4H2,1H3 |
| InChIKey | FEQRVWKNRGJZOQ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.17 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|