C6H6F2N4O3 — CID 119053440
1-(2,2-difluoroethyl)-3-nitropyrazole-4-carboxamide (PubChem CID 119053440) has the molecular formula C6H6F2N4O3 and a molecular weight of 220.13 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-3-nitropyrazole-4-carboxamide.
| Compound Name | 1-(2,2-difluoroethyl)-3-nitropyrazole-4-carboxamide |
|---|---|
| PubChem CID | 119053440 |
| Molecular Formula | C6H6F2N4O3 |
| Molecular Weight | 220.13 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | 1-(2,2-difluoroethyl)-3-nitropyrazole-4-carboxamide |
| SMILES | NC(=O)c1cn(CC(F)F)nc1[N+](=O)[O-] |
| InChI | InChI=1S/C6H6F2N4O3/c7-4(8)2-11-1-3(5(9)13)6(10-11)12(14)15/h1,4H,2H2,(H2,9,13) |
| InChIKey | OYZHJOYLEVBSRE-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.13 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|