C9H13F2N3O2 — CID 177241817
ethyl 2-[[1-(2,2-difluoroethyl)pyrazol-4-yl]amino]acetate (PubChem CID 177241817) has the molecular formula C9H13F2N3O2 and a molecular weight of 233.22 g/mol. Its IUPAC name is ethyl 2-[[1-(2,2-difluoroethyl)pyrazol-4-yl]amino]acetate.
| Compound Name | ethyl 2-[[1-(2,2-difluoroethyl)pyrazol-4-yl]amino]acetate |
|---|---|
| PubChem CID | 177241817 |
| Molecular Formula | C9H13F2N3O2 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | ethyl 2-[[1-(2,2-difluoroethyl)pyrazol-4-yl]amino]acetate |
| SMILES | CCOC(=O)CNc1cnn(CC(F)F)c1 |
| InChI | InChI=1S/C9H13F2N3O2/c1-2-16-9(15)4-12-7-3-13-14(5-7)6-8(10)11/h3,5,8,12H,2,4,6H2,1H3 |
| InChIKey | PCJWOEFZBOMHTH-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |