C7H7F2N3O4 — CID 146569735
methyl 1-(2,2-difluoroethyl)-3-nitropyrazole-5-carboxylate (PubChem CID 146569735) has the molecular formula C7H7F2N3O4 and a molecular weight of 235.15 g/mol. Its IUPAC name is methyl 1-(2,2-difluoroethyl)-3-nitropyrazole-5-carboxylate.
| Compound Name | methyl 1-(2,2-difluoroethyl)-3-nitropyrazole-5-carboxylate |
|---|---|
| PubChem CID | 146569735 |
| Molecular Formula | C7H7F2N3O4 |
| Molecular Weight | 235.15 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | methyl 1-(2,2-difluoroethyl)-3-nitropyrazole-5-carboxylate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])nn1CC(F)F |
| InChI | InChI=1S/C7H7F2N3O4/c1-16-7(13)4-2-6(12(14)15)10-11(4)3-5(8)9/h2,5H,3H2,1H3 |
| InChIKey | HWWOENCSXPESAR-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.15 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|