C18H28N8O6 — CID 161146532
N-methyl-1-(2-methylpropyl)-3-nitropyrazole-5-carboxamide;N-methyl-1-(2-methylpropyl)-5-nitropyrazole-3-carboxamide (PubChem CID 161146532) has the molecular formula C18H28N8O6 and a molecular weight of 452.47 g/mol. Its IUPAC name is N-methyl-1-(2-methylpropyl)-3-nitropyrazole-5-carboxamide;N-methyl-1-(2-methylpropyl)-5-nitropyrazole-3-carboxamide.
| Compound Name | N-methyl-1-(2-methylpropyl)-3-nitropyrazole-5-carboxamide;N-methyl-1-(2-methylpropyl)-5-nitropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 161146532 |
| Molecular Formula | C18H28N8O6 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | N-methyl-1-(2-methylpropyl)-3-nitropyrazole-5-carboxamide;N-methyl-1-(2-methylpropyl)-5-nitropyrazole-3-carboxamide |
| SMILES | CNC(=O)c1cc([N+](=O)[O-])n(CC(C)C)n1.CNC(=O)c1cc([N+](=O)[O-])nn1CC(C)C |
| InChI | InChI=1S/2C9H14N4O3/c1-6(2)5-12-7(9(14)10-3)4-8(11-12)13(15)16;1-6(2)5-12-8(13(15)16)4-7(11-12)9(14)10-3/h2*4,6H,5H2,1-3H3,(H,10,14) |
| InChIKey | UOCXCINZLNBCQK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 180.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|