C12H23N3O — CID 176998703
ethane;1-ethyl-N-methyl-3-propan-2-ylpyrazole-5-carboxamide (PubChem CID 176998703) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is ethane;1-ethyl-N-methyl-3-propan-2-ylpyrazole-5-carboxamide.
| Compound Name | ethane;1-ethyl-N-methyl-3-propan-2-ylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 176998703 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | ethane;1-ethyl-N-methyl-3-propan-2-ylpyrazole-5-carboxamide |
| SMILES | CC.CCn1nc(C(C)C)cc1C(=O)NC |
| InChI | InChI=1S/C10H17N3O.C2H6/c1-5-13-9(10(14)11-4)6-8(12-13)7(2)3;1-2/h6-7H,5H2,1-4H3,(H,11,14);1-2H3 |
| InChIKey | XOYNRWRPGXZLDP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |