C13H21N3O4 — CID 43170287
2-[(1-ethyl-3-propan-2-ylpyrazole-5-carbonyl)amino]-3-hydroxybutanoic acid (PubChem CID 43170287) has the molecular formula C13H21N3O4 and a molecular weight of 283.33 g/mol. Its IUPAC name is 2-[(1-ethyl-3-propan-2-ylpyrazole-5-carbonyl)amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[(1-ethyl-3-propan-2-ylpyrazole-5-carbonyl)amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 43170287 |
| Molecular Formula | C13H21N3O4 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 2-[(1-ethyl-3-propan-2-ylpyrazole-5-carbonyl)amino]-3-hydroxybutanoic acid |
| SMILES | CCn1nc(C(C)C)cc1C(=O)NC(C(=O)O)C(C)O |
| InChI | InChI=1S/C13H21N3O4/c1-5-16-10(6-9(15-16)7(2)3)12(18)14-11(8(4)17)13(19)20/h6-8,11,17H,5H2,1-4H3,(H,14,18)(H,19,20) |
| InChIKey | JEDIPPMNGANPAU-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |