C7H8N4O6 — CID 146680362
3-(3,5-dinitropyrazol-1-yl)-2-methylpropanoic acid (PubChem CID 146680362) has the molecular formula C7H8N4O6 and a molecular weight of 244.16 g/mol. Its IUPAC name is 3-(3,5-dinitropyrazol-1-yl)-2-methylpropanoic acid.
| Compound Name | 3-(3,5-dinitropyrazol-1-yl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 146680362 |
| Molecular Formula | C7H8N4O6 |
| Molecular Weight | 244.16 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 3-(3,5-dinitropyrazol-1-yl)-2-methylpropanoic acid |
| SMILES | CC(Cn1nc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C7H8N4O6/c1-4(7(12)13)3-9-6(11(16)17)2-5(8-9)10(14)15/h2,4H,3H2,1H3,(H,12,13) |
| InChIKey | RSYCGEFXWMBSPU-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 141.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.16 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|