C6H6N4O6 — CID 146680358
2-(3,5-dinitropyrazol-1-yl)propanoic acid (PubChem CID 146680358) has the molecular formula C6H6N4O6 and a molecular weight of 230.14 g/mol. Its IUPAC name is 2-(3,5-dinitropyrazol-1-yl)propanoic acid.
| Compound Name | 2-(3,5-dinitropyrazol-1-yl)propanoic acid |
|---|---|
| PubChem CID | 146680358 |
| Molecular Formula | C6H6N4O6 |
| Molecular Weight | 230.14 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 2-(3,5-dinitropyrazol-1-yl)propanoic acid |
| SMILES | CC(C(=O)O)n1nc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C6H6N4O6/c1-3(6(11)12)8-5(10(15)16)2-4(7-8)9(13)14/h2-3H,1H3,(H,11,12) |
| InChIKey | IWHXZHCGXBACRM-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 141.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.14 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|