C13H11Cl2N3O4 — CID 2988319
ethyl 1-[(3,4-dichlorophenyl)methyl]-3-nitropyrazole-5-carboxylate (PubChem CID 2988319) has the molecular formula C13H11Cl2N3O4 and a molecular weight of 344.15 g/mol. Its IUPAC name is ethyl 1-[(3,4-dichlorophenyl)methyl]-3-nitropyrazole-5-carboxylate.
| Compound Name | ethyl 1-[(3,4-dichlorophenyl)methyl]-3-nitropyrazole-5-carboxylate |
|---|---|
| PubChem CID | 2988319 |
| Molecular Formula | C13H11Cl2N3O4 |
| Molecular Weight | 344.15 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | ethyl 1-[(3,4-dichlorophenyl)methyl]-3-nitropyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc([N+](=O)[O-])nn1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H11Cl2N3O4/c1-2-22-13(19)11-6-12(18(20)21)16-17(11)7-8-3-4-9(14)10(15)5-8/h3-6H,2,7H2,1H3 |
| InChIKey | BBWMQQNZDMOPNX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.15 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|