C18H14Cl2N3O2+ — CID 18522124
1-[(3,4-dichlorophenyl)methyl]-2-ethoxycarbonylindole-4-diazonium (PubChem CID 18522124) has the molecular formula C18H14Cl2N3O2+ and a molecular weight of 375.24 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-2-ethoxycarbonylindole-4-diazonium.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-2-ethoxycarbonylindole-4-diazonium |
|---|---|
| PubChem CID | 18522124 |
| Molecular Formula | C18H14Cl2N3O2+ |
| Molecular Weight | 375.24 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-2-ethoxycarbonylindole-4-diazonium |
| SMILES | CCOC(=O)c1cc2c([N+]#N)cccc2n1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H14Cl2N3O2/c1-2-25-18(24)17-9-12-15(22-21)4-3-5-16(12)23(17)10-11-6-7-13(19)14(20)8-11/h3-9H,2,10H2,1H3/q+1 |
| InChIKey | LBMXEMQTCUFYQW-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.24 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|