C25H21Cl2NO4S — CID 22603402
ethyl 3-benzylsulfonyl-1-[(3,4-dichlorophenyl)methyl]indole-2-carboxylate (PubChem CID 22603402) has the molecular formula C25H21Cl2NO4S and a molecular weight of 502.42 g/mol. Its IUPAC name is ethyl 3-benzylsulfonyl-1-[(3,4-dichlorophenyl)methyl]indole-2-carboxylate.
| Compound Name | ethyl 3-benzylsulfonyl-1-[(3,4-dichlorophenyl)methyl]indole-2-carboxylate |
|---|---|
| PubChem CID | 22603402 |
| Molecular Formula | C25H21Cl2NO4S |
| Molecular Weight | 502.42 g/mol |
| Exact Mass | 501.06 |
| IUPAC Name | ethyl 3-benzylsulfonyl-1-[(3,4-dichlorophenyl)methyl]indole-2-carboxylate |
| SMILES | CCOC(=O)c1c(S(=O)(=O)Cc2ccccc2)c2ccccc2n1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C25H21Cl2NO4S/c1-2-32-25(29)23-24(33(30,31)16-17-8-4-3-5-9-17)19-10-6-7-11-22(19)28(23)15-18-12-13-20(26)21(27)14-18/h3-14H,2,15-16H2,1H3 |
| InChIKey | RDLBLRHUJSMDKB-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.42 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |