C25H21Cl2NOS — CID 86759581
O-ethyl 3-benzyl-1-[(3,4-dichlorophenyl)methyl]indole-2-carbothioate (PubChem CID 86759581) has the molecular formula C25H21Cl2NOS and a molecular weight of 454.42 g/mol. Its IUPAC name is O-ethyl 3-benzyl-1-[(3,4-dichlorophenyl)methyl]indole-2-carbothioate.
| Compound Name | O-ethyl 3-benzyl-1-[(3,4-dichlorophenyl)methyl]indole-2-carbothioate |
|---|---|
| PubChem CID | 86759581 |
| Molecular Formula | C25H21Cl2NOS |
| Molecular Weight | 454.42 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | O-ethyl 3-benzyl-1-[(3,4-dichlorophenyl)methyl]indole-2-carbothioate |
| SMILES | CCOC(=S)c1c(Cc2ccccc2)c2ccccc2n1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C25H21Cl2NOS/c1-2-29-25(30)24-20(14-17-8-4-3-5-9-17)19-10-6-7-11-23(19)28(24)16-18-12-13-21(26)22(27)15-18/h3-13,15H,2,14,16H2,1H3 |
| InChIKey | UYVKZZHTGFMKKO-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.42 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|