C22H22N2OS — CID 87086893
O-ethyl 6-benzyl-2,3-dihydro-1H-azepino[4,5-b]indole-5-carbothioate (PubChem CID 87086893) has the molecular formula C22H22N2OS and a molecular weight of 362.50 g/mol. Its IUPAC name is O-ethyl 6-benzyl-2,3-dihydro-1H-azepino[4,5-b]indole-5-carbothioate.
| Compound Name | O-ethyl 6-benzyl-2,3-dihydro-1H-azepino[4,5-b]indole-5-carbothioate |
|---|---|
| PubChem CID | 87086893 |
| Molecular Formula | C22H22N2OS |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | O-ethyl 6-benzyl-2,3-dihydro-1H-azepino[4,5-b]indole-5-carbothioate |
| SMILES | CCOC(=S)C1=CNCCc2c1n(Cc1ccccc1)c1ccccc21 |
| InChI | InChI=1S/C22H22N2OS/c1-2-25-22(26)19-14-23-13-12-18-17-10-6-7-11-20(17)24(21(18)19)15-16-8-4-3-5-9-16/h3-11,14,23H,2,12-13,15H2,1H3 |
| InChIKey | KBQRTTOJUNAMJQ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|