C18H16N2O3 — CID 53277831
ethyl 3-benzyl-4-oxoquinazoline-2-carboxylate (PubChem CID 53277831) has the molecular formula C18H16N2O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is ethyl 3-benzyl-4-oxoquinazoline-2-carboxylate.
| Compound Name | ethyl 3-benzyl-4-oxoquinazoline-2-carboxylate |
|---|---|
| PubChem CID | 53277831 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | ethyl 3-benzyl-4-oxoquinazoline-2-carboxylate |
| SMILES | CCOC(=O)c1nc2ccccc2c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C18H16N2O3/c1-2-23-18(22)16-19-15-11-7-6-10-14(15)17(21)20(16)12-13-8-4-3-5-9-13/h3-11H,2,12H2,1H3 |
| InChIKey | XCMOIXNKCZMXFK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |