C26H29NO4 — CID 54473969
diethyl 2-(9-benzyl-1,2,3,4-tetrahydrocarbazol-2-yl)propanedioate (PubChem CID 54473969) has the molecular formula C26H29NO4 and a molecular weight of 419.52 g/mol. Its IUPAC name is diethyl 2-(9-benzyl-1,2,3,4-tetrahydrocarbazol-2-yl)propanedioate.
| Compound Name | diethyl 2-(9-benzyl-1,2,3,4-tetrahydrocarbazol-2-yl)propanedioate |
|---|---|
| PubChem CID | 54473969 |
| Molecular Formula | C26H29NO4 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | diethyl 2-(9-benzyl-1,2,3,4-tetrahydrocarbazol-2-yl)propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C1CCc2c(n(Cc3ccccc3)c3ccccc23)C1 |
| InChI | InChI=1S/C26H29NO4/c1-3-30-25(28)24(26(29)31-4-2)19-14-15-21-20-12-8-9-13-22(20)27(23(21)16-19)17-18-10-6-5-7-11-18/h5-13,19,24H,3-4,14-17H2,1-2H3 |
| InChIKey | XKGKHTYPZXSGGA-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|