C31H39NO8 — CID 101030468
tetraethyl 9-benzyl-1,2,3,4,5,6,7,8-octahydrocarbazole-2,3,6,7-tetracarboxylate (PubChem CID 101030468) has the molecular formula C31H39NO8 and a molecular weight of 553.65 g/mol. Its IUPAC name is tetraethyl 9-benzyl-1,2,3,4,5,6,7,8-octahydrocarbazole-2,3,6,7-tetracarboxylate.
| Compound Name | tetraethyl 9-benzyl-1,2,3,4,5,6,7,8-octahydrocarbazole-2,3,6,7-tetracarboxylate |
|---|---|
| PubChem CID | 101030468 |
| Molecular Formula | C31H39NO8 |
| Molecular Weight | 553.65 g/mol |
| Exact Mass | 553.27 |
| IUPAC Name | tetraethyl 9-benzyl-1,2,3,4,5,6,7,8-octahydrocarbazole-2,3,6,7-tetracarboxylate |
| SMILES | CCOC(=O)C1Cc2c3c(n(Cc4ccccc4)c2CC1C(=O)OCC)CC(C(=O)OCC)C(C(=O)OCC)C3 |
| InChI | InChI=1S/C31H39NO8/c1-5-37-28(33)22-14-20-21-15-23(29(34)38-6-2)25(31(36)40-8-4)17-27(21)32(18-19-12-10-9-11-13-19)26(20)16-24(22)30(35)39-7-3/h9-13,22-25H,5-8,14-18H2,1-4H3 |
| InChIKey | DODOCUVMBOZKMV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 110.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.65 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|