C24H27N3O3 — CID 123158809
ethyl 2-[(3R)-3-(benzylcarbamoylamino)-1,2,3,4-tetrahydrocarbazol-9-yl]acetate (PubChem CID 123158809) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is ethyl 2-[(3R)-3-(benzylcarbamoylamino)-1,2,3,4-tetrahydrocarbazol-9-yl]acetate.
| Compound Name | ethyl 2-[(3R)-3-(benzylcarbamoylamino)-1,2,3,4-tetrahydrocarbazol-9-yl]acetate |
|---|---|
| PubChem CID | 123158809 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | ethyl 2-[(3R)-3-(benzylcarbamoylamino)-1,2,3,4-tetrahydrocarbazol-9-yl]acetate |
| SMILES | CCOC(=O)Cn1c2c(c3ccccc31)C[C@H](NC(=O)NCc1ccccc1)CC2 |
| InChI | InChI=1S/C24H27N3O3/c1-2-30-23(28)16-27-21-11-7-6-10-19(21)20-14-18(12-13-22(20)27)26-24(29)25-15-17-8-4-3-5-9-17/h3-11,18H,2,12-16H2,1H3,(H2,25,26,29)/t18-/m1/s1 |
| InChIKey | PHHUJEWTVCLUFN-GOSISDBHSA-N |
| XLogP | 3.56 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|