C18H21NO4 — CID 11483877
ethyl 2-spiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-carbazole]-9'-ylacetate (PubChem CID 11483877) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is ethyl 2-spiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-carbazole]-9'-ylacetate.
| Compound Name | ethyl 2-spiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-carbazole]-9'-ylacetate |
|---|---|
| PubChem CID | 11483877 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | ethyl 2-spiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-carbazole]-9'-ylacetate |
| SMILES | CCOC(=O)Cn1c2c(c3ccccc31)CC1(CC2)OCCO1 |
| InChI | InChI=1S/C18H21NO4/c1-2-21-17(20)12-19-15-6-4-3-5-13(15)14-11-18(8-7-16(14)19)22-9-10-23-18/h3-6H,2,7-12H2,1H3 |
| InChIKey | RXUIJPYBRBLVND-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|