C21H28N2O4 — CID 91140939
ethyl 2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-1,2,3,4-tetrahydrocarbazol-9-yl]acetate (PubChem CID 91140939) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is ethyl 2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-1,2,3,4-tetrahydrocarbazol-9-yl]acetate.
| Compound Name | ethyl 2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-1,2,3,4-tetrahydrocarbazol-9-yl]acetate |
|---|---|
| PubChem CID | 91140939 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | ethyl 2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-1,2,3,4-tetrahydrocarbazol-9-yl]acetate |
| SMILES | CCOC(=O)Cn1c2c(c3ccccc31)CC(NC(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C21H28N2O4/c1-5-26-19(24)13-23-17-9-7-6-8-15(17)16-12-14(10-11-18(16)23)22-20(25)27-21(2,3)4/h6-9,14H,5,10-13H2,1-4H3,(H,22,25) |
| InChIKey | ZRNITUDDUSGKCF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|