C23H25FN2O4S — CID 141187924
ethyl 3-[(3R)-3-[(4-fluorophenyl)sulfonylamino]-1,2,3,4-tetrahydrocarbazol-9-yl]propanoate (PubChem CID 141187924) has the molecular formula C23H25FN2O4S and a molecular weight of 444.53 g/mol. Its IUPAC name is ethyl 3-[(3R)-3-[(4-fluorophenyl)sulfonylamino]-1,2,3,4-tetrahydrocarbazol-9-yl]propanoate.
| Compound Name | ethyl 3-[(3R)-3-[(4-fluorophenyl)sulfonylamino]-1,2,3,4-tetrahydrocarbazol-9-yl]propanoate |
|---|---|
| PubChem CID | 141187924 |
| Molecular Formula | C23H25FN2O4S |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | ethyl 3-[(3R)-3-[(4-fluorophenyl)sulfonylamino]-1,2,3,4-tetrahydrocarbazol-9-yl]propanoate |
| SMILES | CCOC(=O)CCn1c2c(c3ccccc31)C[C@H](NS(=O)(=O)c1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C23H25FN2O4S/c1-2-30-23(27)13-14-26-21-6-4-3-5-19(21)20-15-17(9-12-22(20)26)25-31(28,29)18-10-7-16(24)8-11-18/h3-8,10-11,17,25H,2,9,12-15H2,1H3/t17-/m1/s1 |
| InChIKey | IUMYMQPNRWYIQO-QGZVFWFLSA-N |
| XLogP | 3.57 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|