C21H21FN2O5S — CID 14987078
3-[3-[(4-fluorophenyl)sulfonylamino]-6-hydroxy-1,2,3,4-tetrahydrocarbazol-9-yl]propanoic acid (PubChem CID 14987078) has the molecular formula C21H21FN2O5S and a molecular weight of 432.47 g/mol. Its IUPAC name is 3-[3-[(4-fluorophenyl)sulfonylamino]-6-hydroxy-1,2,3,4-tetrahydrocarbazol-9-yl]propanoic acid.
| Compound Name | 3-[3-[(4-fluorophenyl)sulfonylamino]-6-hydroxy-1,2,3,4-tetrahydrocarbazol-9-yl]propanoic acid |
|---|---|
| PubChem CID | 14987078 |
| Molecular Formula | C21H21FN2O5S |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 3-[3-[(4-fluorophenyl)sulfonylamino]-6-hydroxy-1,2,3,4-tetrahydrocarbazol-9-yl]propanoic acid |
| SMILES | O=C(O)CCn1c2c(c3cc(O)ccc31)CC(NS(=O)(=O)c1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C21H21FN2O5S/c22-13-1-5-16(6-2-13)30(28,29)23-14-3-7-19-17(11-14)18-12-15(25)4-8-20(18)24(19)10-9-21(26)27/h1-2,4-6,8,12,14,23,25H,3,7,9-11H2,(H,26,27) |
| InChIKey | WZDTXQLKRLQJDH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|