C29H35FN2O6S — CID 53250235
3-cyclopentylpropanoic acid;3-[(3R)-3-[(4-fluorophenyl)sulfonylamino]-1,2,3,4-tetrahydrocarbazol-9-yl]propanoic acid (PubChem CID 53250235) has the molecular formula C29H35FN2O6S and a molecular weight of 558.67 g/mol. Its IUPAC name is 3-cyclopentylpropanoic acid;3-[(3R)-3-[(4-fluorophenyl)sulfonylamino]-1,2,3,4-tetrahydrocarbazol-9-yl]propanoic acid.
| Compound Name | 3-cyclopentylpropanoic acid;3-[(3R)-3-[(4-fluorophenyl)sulfonylamino]-1,2,3,4-tetrahydrocarbazol-9-yl]propanoic acid |
|---|---|
| PubChem CID | 53250235 |
| Molecular Formula | C29H35FN2O6S |
| Molecular Weight | 558.67 g/mol |
| Exact Mass | 558.22 |
| IUPAC Name | 3-cyclopentylpropanoic acid;3-[(3R)-3-[(4-fluorophenyl)sulfonylamino]-1,2,3,4-tetrahydrocarbazol-9-yl]propanoic acid |
| SMILES | O=C(O)CCC1CCCC1.O=C(O)CCn1c2c(c3ccccc31)C[C@H](NS(=O)(=O)c1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C21H21FN2O4S.C8H14O2/c22-14-5-8-16(9-6-14)29(27,28)23-15-7-10-20-18(13-15)17-3-1-2-4-19(17)24(20)12-11-21(25)26;9-8(10)6-5-7-3-1-2-4-7/h1-6,8-9,15,23H,7,10-13H2,(H,25,26);7H,1-6H2,(H,9,10)/t15-;/m1./s1 |
| InChIKey | MBENECVJVRMHJH-XFULWGLBSA-N |
| XLogP | 5.13 |
| TPSA | 125.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.67 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|