C22H25N2NaO4S — CID 173377940
sodium;hydride;3-[3-[(4-methylphenyl)sulfonylamino]-1,2,3,4-tetrahydrocarbazol-9-yl]propanoic acid (PubChem CID 173377940) has the molecular formula C22H25N2NaO4S and a molecular weight of 436.51 g/mol. Its IUPAC name is sodium;hydride;3-[3-[(4-methylphenyl)sulfonylamino]-1,2,3,4-tetrahydrocarbazol-9-yl]propanoic acid.
| Compound Name | sodium;hydride;3-[3-[(4-methylphenyl)sulfonylamino]-1,2,3,4-tetrahydrocarbazol-9-yl]propanoic acid |
|---|---|
| PubChem CID | 173377940 |
| Molecular Formula | C22H25N2NaO4S |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | sodium;hydride;3-[3-[(4-methylphenyl)sulfonylamino]-1,2,3,4-tetrahydrocarbazol-9-yl]propanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)NC2CCc3c(c4ccccc4n3CCC(=O)O)C2)cc1.[H-].[Na+] |
| InChI | InChI=1S/C22H24N2O4S.Na.H/c1-15-6-9-17(10-7-15)29(27,28)23-16-8-11-21-19(14-16)18-4-2-3-5-20(18)24(21)13-12-22(25)26;;/h2-7,9-10,16,23H,8,11-14H2,1H3,(H,25,26);;/q;+1;-1 |
| InChIKey | WADCODSMNKZOSL-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|