C22H23FN2O4S — CID 14687304
methyl 3-[3-[(4-fluorophenyl)sulfonylamino]-1,2,3,4-tetrahydrocarbazol-9-yl]propanoate (PubChem CID 14687304) has the molecular formula C22H23FN2O4S and a molecular weight of 430.50 g/mol. Its IUPAC name is methyl 3-[3-[(4-fluorophenyl)sulfonylamino]-1,2,3,4-tetrahydrocarbazol-9-yl]propanoate.
| Compound Name | methyl 3-[3-[(4-fluorophenyl)sulfonylamino]-1,2,3,4-tetrahydrocarbazol-9-yl]propanoate |
|---|---|
| PubChem CID | 14687304 |
| Molecular Formula | C22H23FN2O4S |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | methyl 3-[3-[(4-fluorophenyl)sulfonylamino]-1,2,3,4-tetrahydrocarbazol-9-yl]propanoate |
| SMILES | COC(=O)CCn1c2c(c3ccccc31)CC(NS(=O)(=O)c1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C22H23FN2O4S/c1-29-22(26)12-13-25-20-5-3-2-4-18(20)19-14-16(8-11-21(19)25)24-30(27,28)17-9-6-15(23)7-10-17/h2-7,9-10,16,24H,8,11-14H2,1H3 |
| InChIKey | FKNPQDBLZRRRJU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|