C23H27N3O4S — CID 170652548
3-[3-[[4-(dimethylamino)phenyl]sulfonylamino]-1,2,3,4-tetrahydrocarbazol-9-yl]propanoic acid (PubChem CID 170652548) has the molecular formula C23H27N3O4S and a molecular weight of 441.55 g/mol. Its IUPAC name is 3-[3-[[4-(dimethylamino)phenyl]sulfonylamino]-1,2,3,4-tetrahydrocarbazol-9-yl]propanoic acid.
| Compound Name | 3-[3-[[4-(dimethylamino)phenyl]sulfonylamino]-1,2,3,4-tetrahydrocarbazol-9-yl]propanoic acid |
|---|---|
| PubChem CID | 170652548 |
| Molecular Formula | C23H27N3O4S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 3-[3-[[4-(dimethylamino)phenyl]sulfonylamino]-1,2,3,4-tetrahydrocarbazol-9-yl]propanoic acid |
| SMILES | CN(C)c1ccc(S(=O)(=O)NC2CCc3c(c4ccccc4n3CCC(=O)O)C2)cc1 |
| InChI | InChI=1S/C23H27N3O4S/c1-25(2)17-8-10-18(11-9-17)31(29,30)24-16-7-12-22-20(15-16)19-5-3-4-6-21(19)26(22)14-13-23(27)28/h3-6,8-11,16,24H,7,12-15H2,1-2H3,(H,27,28) |
| InChIKey | YKERXIXFJPXFCO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|