C23H32N2O4S — CID 176830950
3-[3-[methyl-(4-methylcyclohexyl)sulfonylamino]-1,2,3,4-tetrahydrocarbazol-9-yl]propanoic acid (PubChem CID 176830950) has the molecular formula C23H32N2O4S and a molecular weight of 432.59 g/mol. Its IUPAC name is 3-[3-[methyl-(4-methylcyclohexyl)sulfonylamino]-1,2,3,4-tetrahydrocarbazol-9-yl]propanoic acid.
| Compound Name | 3-[3-[methyl-(4-methylcyclohexyl)sulfonylamino]-1,2,3,4-tetrahydrocarbazol-9-yl]propanoic acid |
|---|---|
| PubChem CID | 176830950 |
| Molecular Formula | C23H32N2O4S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 3-[3-[methyl-(4-methylcyclohexyl)sulfonylamino]-1,2,3,4-tetrahydrocarbazol-9-yl]propanoic acid |
| SMILES | CC1CCC(S(=O)(=O)N(C)C2CCc3c(c4ccccc4n3CCC(=O)O)C2)CC1 |
| InChI | InChI=1S/C23H32N2O4S/c1-16-7-10-18(11-8-16)30(28,29)24(2)17-9-12-22-20(15-17)19-5-3-4-6-21(19)25(22)14-13-23(26)27/h3-6,16-18H,7-15H2,1-2H3,(H,26,27) |
| InChIKey | WAVYGRUKGZGOAL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|