C24H24ClFN2O4 — CID 123498838
ethyl 2-[(3R)-3-[[2-(3-chlorophenoxy)acetyl]amino]-6-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl]acetate (PubChem CID 123498838) has the molecular formula C24H24ClFN2O4 and a molecular weight of 458.92 g/mol. Its IUPAC name is ethyl 2-[(3R)-3-[[2-(3-chlorophenoxy)acetyl]amino]-6-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl]acetate.
| Compound Name | ethyl 2-[(3R)-3-[[2-(3-chlorophenoxy)acetyl]amino]-6-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl]acetate |
|---|---|
| PubChem CID | 123498838 |
| Molecular Formula | C24H24ClFN2O4 |
| Molecular Weight | 458.92 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | ethyl 2-[(3R)-3-[[2-(3-chlorophenoxy)acetyl]amino]-6-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl]acetate |
| SMILES | CCOC(=O)Cn1c2c(c3cc(F)ccc31)C[C@H](NC(=O)COc1cccc(Cl)c1)CC2 |
| InChI | InChI=1S/C24H24ClFN2O4/c1-2-31-24(30)13-28-21-8-6-16(26)11-19(21)20-12-17(7-9-22(20)28)27-23(29)14-32-18-5-3-4-15(25)10-18/h3-6,8,10-11,17H,2,7,9,12-14H2,1H3,(H,27,29)/t17-/m1/s1 |
| InChIKey | SBMQGVHAVALKOK-QGZVFWFLSA-N |
| XLogP | 4.05 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.92 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|